About 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one
2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one (PubChem CID 135474303) has the molecular formula C11H11Cl2N5O
and a molecular weight of 300.15 g/mol. Its IUPAC name is 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one |
| PubChem CID | 135474303 |
| Molecular Formula | C11H11Cl2N5O |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Nc1nc(NCc2ccc(Cl)c(Cl)c2)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C11H11Cl2N5O/c12-6-2-1-5(3-7(6)13)4-16-9-8(14)10(19)18-11(15)17-9/h1-3H,4,14H2,(H4,15,16,17,18,19) |
| InChIKey | ZLXXLBIETIKUNL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one?
The IUPAC name of 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one (CID 135474303) is 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one.
What is the SMILES notation for 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one?
The canonical SMILES for 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one is Nc1nc(NCc2ccc(Cl)c(Cl)c2)c(N)c(=O)[nH]1.
What is the InChIKey of 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one?
The InChIKey is ZLXXLBIETIKUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N5O/c12-6-2-1-5(3-7(6)13)4-16-9-8(14)10(19)18-11(15)17-9/h1-3H,4,14H2,(H4,15,16,17,18,19).
What are the key properties of 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one?
2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one has a molecular weight of 300.15 g/mol, XLogP of 1.85, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one is sourced from PubChem (CID 135474303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).