C11H11Cl2N5O — CID 135474303
2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one (PubChem CID 135474303) has the molecular formula C11H11Cl2N5O and a molecular weight of 300.15 g/mol. Its IUPAC name is 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135474303 |
| Molecular Formula | C11H11Cl2N5O |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2,5-diamino-4-[(3,4-dichlorophenyl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Nc1nc(NCc2ccc(Cl)c(Cl)c2)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C11H11Cl2N5O/c12-6-2-1-5(3-7(6)13)4-16-9-8(14)10(19)18-11(15)17-9/h1-3H,4,14H2,(H4,15,16,17,18,19) |
| InChIKey | ZLXXLBIETIKUNL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |