C12H12N6O2 — CID 136829863
2-amino-8-(4-amino-2-methoxyphenyl)-1,7-dihydropurin-6-one (PubChem CID 136829863) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-amino-8-(4-amino-2-methoxyphenyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(4-amino-2-methoxyphenyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136829863 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-amino-8-(4-amino-2-methoxyphenyl)-1,7-dihydropurin-6-one |
| SMILES | COc1cc(N)ccc1-c1nc2nc(N)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C12H12N6O2/c1-20-7-4-5(13)2-3-6(7)9-15-8-10(16-9)17-12(14)18-11(8)19/h2-4H,13H2,1H3,(H4,14,15,16,17,18,19) |
| InChIKey | XYIPYIGWRIFDPN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 135.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|