C12H10FN5O — CID 136843668
2-amino-8-(3-fluoro-5-methylphenyl)-1,7-dihydropurin-6-one (PubChem CID 136843668) has the molecular formula C12H10FN5O and a molecular weight of 259.24 g/mol. Its IUPAC name is 2-amino-8-(3-fluoro-5-methylphenyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(3-fluoro-5-methylphenyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136843668 |
| Molecular Formula | C12H10FN5O |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-amino-8-(3-fluoro-5-methylphenyl)-1,7-dihydropurin-6-one |
| SMILES | Cc1cc(F)cc(-c2nc3nc(N)[nH]c(=O)c3[nH]2)c1 |
| InChI | InChI=1S/C12H10FN5O/c1-5-2-6(4-7(13)3-5)9-15-8-10(16-9)17-12(14)18-11(8)19/h2-4H,1H3,(H4,14,15,16,17,18,19) |
| InChIKey | LHUVSONQNYJFRX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |