C13H13N5 — CID 114608308
8-(3,5-dimethylphenyl)-7H-purin-6-amine (PubChem CID 114608308) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 8-(3,5-dimethylphenyl)-7H-purin-6-amine.
| Compound Name | 8-(3,5-dimethylphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 114608308 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 8-(3,5-dimethylphenyl)-7H-purin-6-amine |
| SMILES | Cc1cc(C)cc(-c2nc3ncnc(N)c3[nH]2)c1 |
| InChI | InChI=1S/C13H13N5/c1-7-3-8(2)5-9(4-7)12-17-10-11(14)15-6-16-13(10)18-12/h3-6H,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | RCFMNUUJQROMMQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |