C12H12N6 — CID 114608073
8-(4-amino-3-methylphenyl)-7H-purin-6-amine (PubChem CID 114608073) has the molecular formula C12H12N6 and a molecular weight of 240.27 g/mol. Its IUPAC name is 8-(4-amino-3-methylphenyl)-7H-purin-6-amine.
| Compound Name | 8-(4-amino-3-methylphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 114608073 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 8-(4-amino-3-methylphenyl)-7H-purin-6-amine |
| SMILES | Cc1cc(-c2nc3ncnc(N)c3[nH]2)ccc1N |
| InChI | InChI=1S/C12H12N6/c1-6-4-7(2-3-8(6)13)11-17-9-10(14)15-5-16-12(9)18-11/h2-5H,13H2,1H3,(H3,14,15,16,17,18) |
| InChIKey | QJERCDHTYUHMQU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|