C9H8N6O — CID 114608408
8-(4-methyl-1,3-oxazol-5-yl)-7H-purin-6-amine (PubChem CID 114608408) has the molecular formula C9H8N6O and a molecular weight of 216.20 g/mol. Its IUPAC name is 8-(4-methyl-1,3-oxazol-5-yl)-7H-purin-6-amine.
| Compound Name | 8-(4-methyl-1,3-oxazol-5-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 114608408 |
| Molecular Formula | C9H8N6O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 8-(4-methyl-1,3-oxazol-5-yl)-7H-purin-6-amine |
| SMILES | Cc1ncoc1-c1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C9H8N6O/c1-4-6(16-3-13-4)9-14-5-7(10)11-2-12-8(5)15-9/h2-3H,1H3,(H3,10,11,12,14,15) |
| InChIKey | PWFOHUMHAWVYND-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |