C11H7BrFN5O — CID 136790568
2-amino-8-(3-bromo-2-fluorophenyl)-1,7-dihydropurin-6-one (PubChem CID 136790568) has the molecular formula C11H7BrFN5O and a molecular weight of 324.11 g/mol. Its IUPAC name is 2-amino-8-(3-bromo-2-fluorophenyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(3-bromo-2-fluorophenyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136790568 |
| Molecular Formula | C11H7BrFN5O |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-amino-8-(3-bromo-2-fluorophenyl)-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(-c3cccc(Br)c3F)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H7BrFN5O/c12-5-3-1-2-4(6(5)13)8-15-7-9(16-8)17-11(14)18-10(7)19/h1-3H,(H4,14,15,16,17,18,19) |
| InChIKey | NGCSZGVWGQLLJI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |