About 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one
4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one (PubChem CID 152778061) has the molecular formula C12H12N4O4
and a molecular weight of 276.25 g/mol. Its IUPAC name is 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
| PubChem CID | 152778061 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2nc(N)c(N=O)c(=O)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C12H12N4O4/c1-19-6-3-4-7(8(5-6)20-2)11-14-10(13)9(16-18)12(17)15-11/h3-5H,1-2H3,(H3,13,14,15,17) |
| InChIKey | TZSYEFOLZXFBTB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one?
The IUPAC name of 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one (CID 152778061) is 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one.
What is the SMILES notation for 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one?
The canonical SMILES for 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one is COc1ccc(-c2nc(N)c(N=O)c(=O)[nH]2)c(OC)c1.
What is the InChIKey of 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one?
The InChIKey is TZSYEFOLZXFBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O4/c1-19-6-3-4-7(8(5-6)20-2)11-14-10(13)9(16-18)12(17)15-11/h3-5H,1-2H3,(H3,13,14,15,17).
What are the key properties of 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one?
4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one has a molecular weight of 276.25 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(2,4-dimethoxyphenyl)-5-nitroso-1H-pyrimidin-6-one is sourced from PubChem (CID 152778061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).