C13H14N2O3 — CID 82295070
2-(2,4-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carbaldehyde (PubChem CID 82295070) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carbaldehyde.
| Compound Name | 2-(2,4-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82295070 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carbaldehyde |
| SMILES | COc1ccc(-c2nc(C=O)c(C)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C13H14N2O3/c1-8-11(7-16)15-13(14-8)10-5-4-9(17-2)6-12(10)18-3/h4-7H,1-3H3,(H,14,15) |
| InChIKey | CFJVZWKYZMQCST-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|