C13H14N2O3S — CID 134315655
N-[2-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]formamide (PubChem CID 134315655) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]formamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]formamide |
|---|---|
| PubChem CID | 134315655 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]formamide |
| SMILES | COc1ccc(-c2nc(C)c(NC=O)s2)c(OC)c1 |
| InChI | InChI=1S/C13H14N2O3S/c1-8-12(14-7-16)19-13(15-8)10-5-4-9(17-2)6-11(10)18-3/h4-7H,1-3H3,(H,14,16) |
| InChIKey | GVMJGVATODBSIN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|