C14H18N2O4S — CID 154905260
5-(2,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-2-amine;formic acid (PubChem CID 154905260) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-2-amine;formic acid.
| Compound Name | 5-(2,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-2-amine;formic acid |
|---|---|
| PubChem CID | 154905260 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-2-amine;formic acid |
| SMILES | CNc1nc(C)c(-c2ccc(OC)cc2OC)s1.O=CO |
| InChI | InChI=1S/C13H16N2O2S.CH2O2/c1-8-12(18-13(14-2)15-8)10-6-5-9(16-3)7-11(10)17-4;2-1-3/h5-7H,1-4H3,(H,14,15);1H,(H,2,3) |
| InChIKey | MQNFWVXRNIRBSI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|