C13H15N3O2S2 — CID 87267219
1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxyphenyl]-3-sulfanylurea (PubChem CID 87267219) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxyphenyl]-3-sulfanylurea.
| Compound Name | 1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxyphenyl]-3-sulfanylurea |
|---|---|
| PubChem CID | 87267219 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxyphenyl]-3-sulfanylurea |
| SMILES | COc1cc(NC(=O)NS)ccc1-c1sc(C)nc1C |
| InChI | InChI=1S/C13H15N3O2S2/c1-7-12(20-8(2)14-7)10-5-4-9(6-11(10)18-3)15-13(17)16-19/h4-6,19H,1-3H3,(H2,15,16,17) |
| InChIKey | ZHABENKWKBGVKP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|