C10H8N4O3 — CID 152778097
4-amino-2-(4-hydroxyphenyl)-5-nitroso-1H-pyrimidin-6-one (PubChem CID 152778097) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 4-amino-2-(4-hydroxyphenyl)-5-nitroso-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(4-hydroxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 152778097 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 4-amino-2-(4-hydroxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
| SMILES | Nc1nc(-c2ccc(O)cc2)[nH]c(=O)c1N=O |
| InChI | InChI=1S/C10H8N4O3/c11-8-7(14-17)10(16)13-9(12-8)5-1-3-6(15)4-2-5/h1-4,15H,(H3,11,12,13,16) |
| InChIKey | GFYXFPYSOONXBM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |