C13H13FN4O3 — CID 135967800
4-amino-2-(5-fluoro-2-propoxyphenyl)-5-nitroso-1H-pyrimidin-6-one (PubChem CID 135967800) has the molecular formula C13H13FN4O3 and a molecular weight of 292.27 g/mol. Its IUPAC name is 4-amino-2-(5-fluoro-2-propoxyphenyl)-5-nitroso-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(5-fluoro-2-propoxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135967800 |
| Molecular Formula | C13H13FN4O3 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-amino-2-(5-fluoro-2-propoxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
| SMILES | CCCOc1ccc(F)cc1-c1nc(N)c(N=O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H13FN4O3/c1-2-5-21-9-4-3-7(14)6-8(9)12-16-11(15)10(18-20)13(19)17-12/h3-4,6H,2,5H2,1H3,(H3,15,16,17,19) |
| InChIKey | FJXASEFFANPXNN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |