C15H15N3O2S — CID 139672525
2-(5-amino-2-propoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 139672525) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(5-amino-2-propoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(5-amino-2-propoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 139672525 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(5-amino-2-propoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCOc1ccc(N)cc1-c1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H15N3O2S/c1-2-6-20-12-4-3-9(16)8-10(12)14-17-11-5-7-21-13(11)15(19)18-14/h3-5,7-8H,2,6,16H2,1H3,(H,17,18,19) |
| InChIKey | NNXVRTPCCKZNQE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|