C21H39N3O2 — CID 143044714
2-(5-amino-2-propoxyphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;ethane (PubChem CID 143044714) has the molecular formula C21H39N3O2 and a molecular weight of 365.56 g/mol. Its IUPAC name is 2-(5-amino-2-propoxyphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;ethane.
| Compound Name | 2-(5-amino-2-propoxyphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;ethane |
|---|---|
| PubChem CID | 143044714 |
| Molecular Formula | C21H39N3O2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | 2-(5-amino-2-propoxyphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;ethane |
| SMILES | CC.CC.CC.CCCOc1ccc(N)cc1C1=NC(C)C(C)C(=O)N1 |
| InChI | InChI=1S/C15H21N3O2.3C2H6/c1-4-7-20-13-6-5-11(16)8-12(13)14-17-10(3)9(2)15(19)18-14;3*1-2/h5-6,8-10H,4,7,16H2,1-3H3,(H,17,18,19);3*1-2H3 |
| InChIKey | NFWOAWOTZRHFJE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|