C15H14N4O2 — CID 135670793
2-(2-propoxyphenyl)-3H-pteridin-4-one (PubChem CID 135670793) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(2-propoxyphenyl)-3H-pteridin-4-one.
| Compound Name | 2-(2-propoxyphenyl)-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135670793 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-(2-propoxyphenyl)-3H-pteridin-4-one |
| SMILES | CCCOc1ccccc1-c1nc2nccnc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H14N4O2/c1-2-9-21-11-6-4-3-5-10(11)13-18-14-12(15(20)19-13)16-7-8-17-14/h3-8H,2,9H2,1H3,(H,17,18,19,20) |
| InChIKey | RRJBLMIIOWAQLT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |