C15H16N6O2 — CID 135670787
2-hydrazinyl-7-(2-propoxyphenyl)-6H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 135670787) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-hydrazinyl-7-(2-propoxyphenyl)-6H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 2-hydrazinyl-7-(2-propoxyphenyl)-6H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 135670787 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-hydrazinyl-7-(2-propoxyphenyl)-6H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CCCOc1ccccc1-c1nc2nc(NN)ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N6O2/c1-2-7-23-11-6-4-3-5-9(11)12-18-13-10(14(22)19-12)8-17-15(20-13)21-16/h3-6,8H,2,7,16H2,1H3,(H2,17,18,19,20,21,22) |
| InChIKey | OLOVNCMUOBKFSU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|