C13H15N3O2S — CID 106521583
2-methoxy-6-(2-propoxyphenyl)-1H-1,3,5-triazine-4-thione (PubChem CID 106521583) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-methoxy-6-(2-propoxyphenyl)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-methoxy-6-(2-propoxyphenyl)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 106521583 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-methoxy-6-(2-propoxyphenyl)-1H-1,3,5-triazine-4-thione |
| SMILES | CCCOc1ccccc1-c1nc(=S)nc(OC)[nH]1 |
| InChI | InChI=1S/C13H15N3O2S/c1-3-8-18-10-7-5-4-6-9(10)11-14-12(17-2)16-13(19)15-11/h4-7H,3,8H2,1-2H3,(H,14,15,16,19) |
| InChIKey | CLVBRFSAJHUXML-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|