C10H7Cl2N3OS — CID 106514087
2-(2,3-dichlorophenyl)-6-methoxy-1H-1,3,5-triazine-4-thione (PubChem CID 106514087) has the molecular formula C10H7Cl2N3OS and a molecular weight of 288.16 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-6-methoxy-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-(2,3-dichlorophenyl)-6-methoxy-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 106514087 |
| Molecular Formula | C10H7Cl2N3OS |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-6-methoxy-1H-1,3,5-triazine-4-thione |
| SMILES | COc1nc(=S)nc(-c2cccc(Cl)c2Cl)[nH]1 |
| InChI | InChI=1S/C10H7Cl2N3OS/c1-16-9-13-8(14-10(17)15-9)5-3-2-4-6(11)7(5)12/h2-4H,1H3,(H,13,14,15,17) |
| InChIKey | WVWONVYOKVJMEN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|