C12H11N3O2S — CID 106522429
2-(2,3-dihydro-1-benzofuran-7-yl)-6-methoxy-1H-1,3,5-triazine-4-thione (PubChem CID 106522429) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-7-yl)-6-methoxy-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-7-yl)-6-methoxy-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 106522429 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-7-yl)-6-methoxy-1H-1,3,5-triazine-4-thione |
| SMILES | COc1nc(=S)nc(-c2cccc3c2OCC3)[nH]1 |
| InChI | InChI=1S/C12H11N3O2S/c1-16-11-13-10(14-12(18)15-11)8-4-2-3-7-5-6-17-9(7)8/h2-4H,5-6H2,1H3,(H,13,14,15,18) |
| InChIKey | YCBITDXTYFMRKH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|