C8H7N3O2S — CID 106518179
2-(furan-2-yl)-6-methoxy-1H-1,3,5-triazine-4-thione (PubChem CID 106518179) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-methoxy-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-(furan-2-yl)-6-methoxy-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 106518179 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-(furan-2-yl)-6-methoxy-1H-1,3,5-triazine-4-thione |
| SMILES | COc1nc(=S)nc(-c2ccco2)[nH]1 |
| InChI | InChI=1S/C8H7N3O2S/c1-12-7-9-6(10-8(14)11-7)5-3-2-4-13-5/h2-4H,1H3,(H,9,10,11,14) |
| InChIKey | ADUQVFDOUUBQPB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|