C10H7N3OS — CID 134693303
2-(furan-2-yl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 134693303) has the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(furan-2-yl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 134693303 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-(furan-2-yl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1[nH]c(-c2ccco2)nc(=S)c1C#N |
| InChI | InChI=1S/C10H7N3OS/c1-6-7(5-11)10(15)13-9(12-6)8-3-2-4-14-8/h2-4H,1H3,(H,12,13,15) |
| InChIKey | VFGFTVYPZKBQIO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|