C9H5N3O2 — CID 82281081
2-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 82281081) has the molecular formula C9H5N3O2 and a molecular weight of 187.16 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 82281081 |
| Molecular Formula | C9H5N3O2 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(-c2ccco2)[nH]c1=O |
| InChI | InChI=1S/C9H5N3O2/c10-4-6-5-11-8(12-9(6)13)7-2-1-3-14-7/h1-3,5H,(H,11,12,13) |
| InChIKey | ZDWNWJAGFGGLFB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |