C13H7N3O3 — CID 10106289
3,4-bis(furan-2-yl)-6-oxo-1H-pyridazine-5-carbonitrile (PubChem CID 10106289) has the molecular formula C13H7N3O3 and a molecular weight of 253.22 g/mol. Its IUPAC name is 3,4-bis(furan-2-yl)-6-oxo-1H-pyridazine-5-carbonitrile.
| Compound Name | 3,4-bis(furan-2-yl)-6-oxo-1H-pyridazine-5-carbonitrile |
|---|---|
| PubChem CID | 10106289 |
| Molecular Formula | C13H7N3O3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3,4-bis(furan-2-yl)-6-oxo-1H-pyridazine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccco2)c(-c2ccco2)n[nH]c1=O |
| InChI | InChI=1S/C13H7N3O3/c14-7-8-11(9-3-1-5-18-9)12(15-16-13(8)17)10-4-2-6-19-10/h1-6H,(H,16,17) |
| InChIKey | CURKBGKGYKGVPU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |