C17H8N2O5 — CID 3426766
4-amino-6,7-bis(furan-2-yl)-1,3-dioxo-2-benzofuran-5-carbonitrile (PubChem CID 3426766) has the molecular formula C17H8N2O5 and a molecular weight of 320.26 g/mol. Its IUPAC name is 4-amino-6,7-bis(furan-2-yl)-1,3-dioxo-2-benzofuran-5-carbonitrile.
| Compound Name | 4-amino-6,7-bis(furan-2-yl)-1,3-dioxo-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 3426766 |
| Molecular Formula | C17H8N2O5 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-amino-6,7-bis(furan-2-yl)-1,3-dioxo-2-benzofuran-5-carbonitrile |
| SMILES | N#Cc1c(N)c2c(c(-c3ccco3)c1-c1ccco1)C(=O)OC2=O |
| InChI | InChI=1S/C17H8N2O5/c18-7-8-11(9-3-1-5-22-9)12(10-4-2-6-23-10)13-14(15(8)19)17(21)24-16(13)20/h1-6H,19H2 |
| InChIKey | ZGVBARQZWDAORD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|