C11H4Cl2FNO — CID 168524830
3,5-dichloro-2-fluoro-6-(furan-2-yl)benzonitrile (PubChem CID 168524830) has the molecular formula C11H4Cl2FNO and a molecular weight of 256.06 g/mol. Its IUPAC name is 3,5-dichloro-2-fluoro-6-(furan-2-yl)benzonitrile.
| Compound Name | 3,5-dichloro-2-fluoro-6-(furan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 168524830 |
| Molecular Formula | C11H4Cl2FNO |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | 3,5-dichloro-2-fluoro-6-(furan-2-yl)benzonitrile |
| SMILES | N#Cc1c(F)c(Cl)cc(Cl)c1-c1ccco1 |
| InChI | InChI=1S/C11H4Cl2FNO/c12-7-4-8(13)11(14)6(5-15)10(7)9-2-1-3-16-9/h1-4H |
| InChIKey | CWBAZXHIARUGPJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|