C10H5Cl3O — CID 91803022
2-(2,4,6-trichlorophenyl)furan (PubChem CID 91803022) has the molecular formula C10H5Cl3O and a molecular weight of 247.51 g/mol. Its IUPAC name is 2-(2,4,6-trichlorophenyl)furan.
| Compound Name | 2-(2,4,6-trichlorophenyl)furan |
|---|---|
| PubChem CID | 91803022 |
| Molecular Formula | C10H5Cl3O |
| Molecular Weight | 247.51 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 2-(2,4,6-trichlorophenyl)furan |
| SMILES | Clc1cc(Cl)c(-c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C10H5Cl3O/c11-6-4-7(12)10(8(13)5-6)9-2-1-3-14-9/h1-5H |
| InChIKey | OPAMSTKIKQICGL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |