C11H5N4OSe- — CID 15326256
6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-selenolate (PubChem CID 15326256) has the molecular formula C11H5N4OSe- and a molecular weight of 288.15 g/mol. Its IUPAC name is 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-selenolate.
| Compound Name | 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-selenolate |
|---|---|
| PubChem CID | 15326256 |
| Molecular Formula | C11H5N4OSe- |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-selenolate |
| SMILES | N#Cc1c(N)nc([Se-])c(C#N)c1-c1ccco1 |
| InChI | InChI=1S/C11H6N4OSe/c12-4-6-9(8-2-1-3-16-8)7(5-13)11(17)15-10(6)14/h1-3H,(H3,14,15,17)/p-1 |
| InChIKey | WGRDMLUSRPLFKF-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|