C11H7N3O2S — CID 137161096
4-(furan-2-yl)-5-methanimidoyl-2-oxo-6-sulfanyl-1H-pyridine-3-carbonitrile (PubChem CID 137161096) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-(furan-2-yl)-5-methanimidoyl-2-oxo-6-sulfanyl-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(furan-2-yl)-5-methanimidoyl-2-oxo-6-sulfanyl-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137161096 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 4-(furan-2-yl)-5-methanimidoyl-2-oxo-6-sulfanyl-1H-pyridine-3-carbonitrile |
| SMILES | [H]/N=C/c1c(S)[nH]c(=O)c(C#N)c1-c1ccco1 |
| InChI | InChI=1S/C11H7N3O2S/c12-4-6-9(8-2-1-3-16-8)7(5-13)11(17)14-10(6)15/h1-3,5,13H,(H2,14,15,17)/b13-5+ |
| InChIKey | OLYATXURGDSDGM-WLRTZDKTSA-N |
| XLogP | 1.79 |
| TPSA | 93.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|