C17H11IN2O3 — CID 139755848
6-(furan-2-yl)-5-iodo-4-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 139755848) has the molecular formula C17H11IN2O3 and a molecular weight of 418.19 g/mol. Its IUPAC name is 6-(furan-2-yl)-5-iodo-4-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(furan-2-yl)-5-iodo-4-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139755848 |
| Molecular Formula | C17H11IN2O3 |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 6-(furan-2-yl)-5-iodo-4-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2c(I)c(-c3ccco3)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C17H11IN2O3/c1-22-11-6-4-10(5-7-11)14-12(9-19)17(21)20-16(15(14)18)13-3-2-8-23-13/h2-8H,1H3,(H,20,21) |
| InChIKey | DRPOKYHPEWGAOK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|