C17H13N5O — CID 11587541
3,4-bis(4-aminophenyl)-6-oxo-1H-pyridazine-5-carbonitrile (PubChem CID 11587541) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 3,4-bis(4-aminophenyl)-6-oxo-1H-pyridazine-5-carbonitrile.
| Compound Name | 3,4-bis(4-aminophenyl)-6-oxo-1H-pyridazine-5-carbonitrile |
|---|---|
| PubChem CID | 11587541 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3,4-bis(4-aminophenyl)-6-oxo-1H-pyridazine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(N)cc2)c(-c2ccc(N)cc2)n[nH]c1=O |
| InChI | InChI=1S/C17H13N5O/c18-9-14-15(10-1-5-12(19)6-2-10)16(21-22-17(14)23)11-3-7-13(20)8-4-11/h1-8H,19-20H2,(H,22,23) |
| InChIKey | BLQXUDYSNPIOLJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|