C12H8FN3O2 — CID 107923253
2-(4-fluoro-3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 107923253) has the molecular formula C12H8FN3O2 and a molecular weight of 245.21 g/mol. Its IUPAC name is 2-(4-fluoro-3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(4-fluoro-3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 107923253 |
| Molecular Formula | C12H8FN3O2 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-(4-fluoro-3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(-c2ncc(C#N)c(=O)[nH]2)ccc1F |
| InChI | InChI=1S/C12H8FN3O2/c1-18-10-4-7(2-3-9(10)13)11-15-6-8(5-14)12(17)16-11/h2-4,6H,1H3,(H,15,16,17) |
| InChIKey | OSZYNESYMNTDRK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |