C13H8N4S — CID 143172162
2-(4-cyanophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 143172162) has the molecular formula C13H8N4S and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(4-cyanophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 143172162 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(4-cyanophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1[nH]c(-c2ccc(C#N)cc2)nc(=S)c1C#N |
| InChI | InChI=1S/C13H8N4S/c1-8-11(7-15)13(18)17-12(16-8)10-4-2-9(6-14)3-5-10/h2-5H,1H3,(H,16,17,18) |
| InChIKey | FTYRJHFPBHTFMI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|