C15H10N4S — CID 143172186
6-methyl-2-quinolin-6-yl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 143172186) has the molecular formula C15H10N4S and a molecular weight of 278.34 g/mol. Its IUPAC name is 6-methyl-2-quinolin-6-yl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-methyl-2-quinolin-6-yl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 143172186 |
| Molecular Formula | C15H10N4S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 6-methyl-2-quinolin-6-yl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1[nH]c(-c2ccc3ncccc3c2)nc(=S)c1C#N |
| InChI | InChI=1S/C15H10N4S/c1-9-12(8-16)15(20)19-14(18-9)11-4-5-13-10(7-11)3-2-6-17-13/h2-7H,1H3,(H,18,19,20) |
| InChIKey | ZJSYBGJGVOXRMO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|