C16H20N4O3 — CID 152778090
4-amino-2-(3-hexoxyphenyl)-5-nitroso-1H-pyrimidin-6-one (PubChem CID 152778090) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-amino-2-(3-hexoxyphenyl)-5-nitroso-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(3-hexoxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 152778090 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-amino-2-(3-hexoxyphenyl)-5-nitroso-1H-pyrimidin-6-one |
| SMILES | CCCCCCOc1cccc(-c2nc(N)c(N=O)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C16H20N4O3/c1-2-3-4-5-9-23-12-8-6-7-11(10-12)15-18-14(17)13(20-22)16(21)19-15/h6-8,10H,2-5,9H2,1H3,(H3,17,18,19,21) |
| InChIKey | NTVOACFIKGIXMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|