C16H22N4O2 — CID 152771806
4,5-diamino-2-(3-hexoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 152771806) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4,5-diamino-2-(3-hexoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 4,5-diamino-2-(3-hexoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 152771806 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4,5-diamino-2-(3-hexoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | CCCCCCOc1cccc(-c2nc(N)c(N)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C16H22N4O2/c1-2-3-4-5-9-22-12-8-6-7-11(10-12)15-19-14(18)13(17)16(21)20-15/h6-8,10H,2-5,9,17H2,1H3,(H3,18,19,20,21) |
| InChIKey | BVLBQHFYHLYAFJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|