C4H8N4O — CID 69334697
4-methoxy-1H-imidazole-2,5-diamine (PubChem CID 69334697) has the molecular formula C4H8N4O and a molecular weight of 128.13 g/mol. Its IUPAC name is 4-methoxy-1H-imidazole-2,5-diamine.
| Compound Name | 4-methoxy-1H-imidazole-2,5-diamine |
|---|---|
| PubChem CID | 69334697 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 4-methoxy-1H-imidazole-2,5-diamine |
| SMILES | COc1nc(N)[nH]c1N |
| InChI | InChI=1S/C4H8N4O/c1-9-3-2(5)7-4(6)8-3/h5H2,1H3,(H3,6,7,8) |
| InChIKey | PMWPXGHVHSDJGB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |