C7H8F2N2O2 — CID 170648727
3,5-difluoro-2,6-dimethoxypyridin-4-amine (PubChem CID 170648727) has the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. Its IUPAC name is 3,5-difluoro-2,6-dimethoxypyridin-4-amine.
| Compound Name | 3,5-difluoro-2,6-dimethoxypyridin-4-amine |
|---|---|
| PubChem CID | 170648727 |
| Molecular Formula | C7H8F2N2O2 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3,5-difluoro-2,6-dimethoxypyridin-4-amine |
| SMILES | COc1nc(OC)c(F)c(N)c1F |
| InChI | InChI=1S/C7H8F2N2O2/c1-12-6-3(8)5(10)4(9)7(11-6)13-2/h1-2H3,(H2,10,11) |
| InChIKey | VQDXWPPOFHLIDZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |