C11H9F2N3O — CID 165455636
2,6-difluoro-3-(4-methoxypyrimidin-5-yl)aniline (PubChem CID 165455636) has the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. Its IUPAC name is 2,6-difluoro-3-(4-methoxypyrimidin-5-yl)aniline.
| Compound Name | 2,6-difluoro-3-(4-methoxypyrimidin-5-yl)aniline |
|---|---|
| PubChem CID | 165455636 |
| Molecular Formula | C11H9F2N3O |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2,6-difluoro-3-(4-methoxypyrimidin-5-yl)aniline |
| SMILES | COc1ncncc1-c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C11H9F2N3O/c1-17-11-7(4-15-5-16-11)6-2-3-8(12)10(14)9(6)13/h2-5H,14H2,1H3 |
| InChIKey | LBGAEPLTBKKDMN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|