C12H20N6O — CID 136952842
2-amino-8-(2-amino-4,4-dimethylpentyl)-1,7-dihydropurin-6-one (PubChem CID 136952842) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-amino-8-(2-amino-4,4-dimethylpentyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(2-amino-4,4-dimethylpentyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136952842 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-amino-8-(2-amino-4,4-dimethylpentyl)-1,7-dihydropurin-6-one |
| SMILES | CC(C)(C)CC(N)Cc1nc2nc(N)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C12H20N6O/c1-12(2,3)5-6(13)4-7-15-8-9(16-7)17-11(14)18-10(8)19/h6H,4-5,13H2,1-3H3,(H4,14,15,16,17,18,19) |
| InChIKey | YAKZMJJWYQZHEB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |