C5H4N8O — CID 135406871
2-amino-8-azido-1,7-dihydropurin-6-one (PubChem CID 135406871) has the molecular formula C5H4N8O and a molecular weight of 192.14 g/mol. Its IUPAC name is 2-amino-8-azido-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-azido-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135406871 |
| Molecular Formula | C5H4N8O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-amino-8-azido-1,7-dihydropurin-6-one |
| SMILES | [N-]=[N+]=Nc1nc2nc(N)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C5H4N8O/c6-4-9-2-1(3(14)11-4)8-5(10-2)12-13-7/h(H4,6,8,9,10,11,14) |
| InChIKey | DDSHZDINIJDYTA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|