C7H9N5O — CID 136659280
8-ethyl-2-(tritioamino)-1,7-dihydropurin-6-one (PubChem CID 136659280) has the molecular formula C7H9N5O and a molecular weight of 181.19 g/mol. Its IUPAC name is 8-ethyl-2-(tritioamino)-1,7-dihydropurin-6-one.
| Compound Name | 8-ethyl-2-(tritioamino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136659280 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 8-ethyl-2-(tritioamino)-1,7-dihydropurin-6-one |
| SMILES | [3H]Nc1nc2nc(CC)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H9N5O/c1-2-3-9-4-5(10-3)11-7(8)12-6(4)13/h2H2,1H3,(H4,8,9,10,11,12,13)/i/hT |
| InChIKey | NKXLJLHQYAGJLG-MNYXATJNSA-N |
| XLogP | -0.21 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |