C9H14N8O2 — CID 137309429
6-amino-8-[(E)-[ethyl(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one (PubChem CID 137309429) has the molecular formula C9H14N8O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 6-amino-8-[(E)-[ethyl(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one.
| Compound Name | 6-amino-8-[(E)-[ethyl(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 137309429 |
| Molecular Formula | C9H14N8O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-amino-8-[(E)-[ethyl(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one |
| SMILES | CCN(CCO)/N=N/c1nc2nc(=O)[nH]c(N)c2[nH]1 |
| InChI | InChI=1S/C9H14N8O2/c1-2-17(3-4-18)16-15-8-11-5-6(10)12-9(19)14-7(5)13-8/h18H,2-4H2,1H3,(H4,10,11,12,13,14,19)/b16-15+ |
| InChIKey | PUJXOSPCKCMENL-FOCLMDBBSA-N |
| XLogP | -0.46 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|