C11H13N5O5S — CID 136594650
(2S)-2-[formyl(hydroxy)amino]-5-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]pentanoic acid (PubChem CID 136594650) has the molecular formula C11H13N5O5S and a molecular weight of 327.32 g/mol. Its IUPAC name is (2S)-2-[formyl(hydroxy)amino]-5-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]pentanoic acid.
| Compound Name | (2S)-2-[formyl(hydroxy)amino]-5-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 136594650 |
| Molecular Formula | C11H13N5O5S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (2S)-2-[formyl(hydroxy)amino]-5-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]pentanoic acid |
| SMILES | O=CN(O)[C@@H](CCCSc1nc2nc[nH]c(=O)c2[nH]1)C(=O)O |
| InChI | InChI=1S/C11H13N5O5S/c17-5-16(21)6(10(19)20)2-1-3-22-11-14-7-8(15-11)12-4-13-9(7)18/h4-6,21H,1-3H2,(H,19,20)(H2,12,13,14,15,18)/t6-/m0/s1 |
| InChIKey | DQHZKTHWNDBKHQ-LURJTMIESA-N |
| XLogP | -0.18 |
| TPSA | 152.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|