C11H12N6O6S — CID 135909525
(2S)-2-[formyl(hydroxy)amino]-3-oxo-3-[2-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]ethylamino]propanoic acid (PubChem CID 135909525) has the molecular formula C11H12N6O6S and a molecular weight of 356.32 g/mol. Its IUPAC name is (2S)-2-[formyl(hydroxy)amino]-3-oxo-3-[2-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]ethylamino]propanoic acid.
| Compound Name | (2S)-2-[formyl(hydroxy)amino]-3-oxo-3-[2-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 135909525 |
| Molecular Formula | C11H12N6O6S |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (2S)-2-[formyl(hydroxy)amino]-3-oxo-3-[2-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]ethylamino]propanoic acid |
| SMILES | O=CN(O)[C@H](C(=O)O)C(=O)NCCSc1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C11H12N6O6S/c18-4-17(23)6(10(21)22)9(20)12-1-2-24-11-15-5-7(16-11)13-3-14-8(5)19/h3-4,6,23H,1-2H2,(H,12,20)(H,21,22)(H2,13,14,15,16,19)/t6-/m0/s1 |
| InChIKey | FYLFTPWWQDJCGU-LURJTMIESA-N |
| XLogP | -1.84 |
| TPSA | 181.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|