C19H15N3OS — CID 67473771
1-(4-aminophenyl)-2-(1H-benzo[f]benzimidazol-2-ylsulfanyl)ethanone (PubChem CID 67473771) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(1H-benzo[f]benzimidazol-2-ylsulfanyl)ethanone.
| Compound Name | 1-(4-aminophenyl)-2-(1H-benzo[f]benzimidazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 67473771 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-(4-aminophenyl)-2-(1H-benzo[f]benzimidazol-2-ylsulfanyl)ethanone |
| SMILES | Nc1ccc(C(=O)CSc2nc3cc4ccccc4cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H15N3OS/c20-15-7-5-12(6-8-15)18(23)11-24-19-21-16-9-13-3-1-2-4-14(13)10-17(16)22-19/h1-10H,11,20H2,(H,21,22) |
| InChIKey | UCCABSYGWLWMQE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|