C11H9N7O3S2 — CID 5148393
4-[(2-amino-6-sulfanylidene-3,7-dihydropurin-8-yl)diazenyl]benzenesulfonic acid (PubChem CID 5148393) has the molecular formula C11H9N7O3S2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 4-[(2-amino-6-sulfanylidene-3,7-dihydropurin-8-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(2-amino-6-sulfanylidene-3,7-dihydropurin-8-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 5148393 |
| Molecular Formula | C11H9N7O3S2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-[(2-amino-6-sulfanylidene-3,7-dihydropurin-8-yl)diazenyl]benzenesulfonic acid |
| SMILES | Nc1nc(=S)c2[nH]c(/N=N/c3ccc(S(=O)(=O)O)cc3)nc2[nH]1 |
| InChI | InChI=1S/C11H9N7O3S2/c12-10-14-8-7(9(22)16-10)13-11(15-8)18-17-5-1-3-6(4-2-5)23(19,20)21/h1-4H,(H,19,20,21)(H4,12,13,14,15,16,22)/b18-17+ |
| InChIKey | GVBGTUMYBKLQNN-ISLYRVAYSA-N |
| XLogP | 2.26 |
| TPSA | 162.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|