C16H14N4O3S — CID 141240071
4-[(8-amino-2-methylquinolin-5-yl)diazenyl]benzenesulfonic acid (PubChem CID 141240071) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-[(8-amino-2-methylquinolin-5-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(8-amino-2-methylquinolin-5-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 141240071 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-[(8-amino-2-methylquinolin-5-yl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccc2c(/N=N/c3ccc(S(=O)(=O)O)cc3)ccc(N)c2n1 |
| InChI | InChI=1S/C16H14N4O3S/c1-10-2-7-13-15(9-8-14(17)16(13)18-10)20-19-11-3-5-12(6-4-11)24(21,22)23/h2-9H,17H2,1H3,(H,21,22,23)/b20-19+ |
| InChIKey | YMMMTMKWGXAYLK-FMQUCBEESA-N |
| XLogP | 3.79 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|