C24H20N6O8S3 — CID 11115006
4-amino-3-[[4-[4-[(2-amino-5-sulfophenyl)diazenyl]phenyl]sulfonylphenyl]diazenyl]benzenesulfonic acid (PubChem CID 11115006) has the molecular formula C24H20N6O8S3 and a molecular weight of 616.66 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(2-amino-5-sulfophenyl)diazenyl]phenyl]sulfonylphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[(2-amino-5-sulfophenyl)diazenyl]phenyl]sulfonylphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 11115006 |
| Molecular Formula | C24H20N6O8S3 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.05 |
| IUPAC Name | 4-amino-3-[[4-[4-[(2-amino-5-sulfophenyl)diazenyl]phenyl]sulfonylphenyl]diazenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)cc1/N=N/c1ccc(S(=O)(=O)c2ccc(/N=N/c3cc(S(=O)(=O)O)ccc3N)cc2)cc1 |
| InChI | InChI=1S/C24H20N6O8S3/c25-21-11-9-19(40(33,34)35)13-23(21)29-27-15-1-5-17(6-2-15)39(31,32)18-7-3-16(4-8-18)28-30-24-14-20(41(36,37)38)10-12-22(24)26/h1-14H,25-26H2,(H,33,34,35)(H,36,37,38)/b29-27+,30-28+ |
| InChIKey | RTFRBYUSIHPJRU-QAVVBOBSSA-N |
| XLogP | 5.01 |
| TPSA | 244.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|